C20H20N6 — CID 71859490
1-(2-imidazol-1-yl-4-pyridinyl)-N-[(2-methyl-3-phenylimidazol-4-yl)methyl]methanamine (PubChem CID 71859490) has the molecular formula C20H20N6 and a molecular weight of 344.42 g/mol. Its IUPAC name is 1-(2-imidazol-1-yl-4-pyridinyl)-N-[(2-methyl-3-phenylimidazol-4-yl)methyl]methanamine.
| Compound Name | 1-(2-imidazol-1-yl-4-pyridinyl)-N-[(2-methyl-3-phenylimidazol-4-yl)methyl]methanamine |
|---|---|
| PubChem CID | 71859490 |
| Molecular Formula | C20H20N6 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 1-(2-imidazol-1-yl-4-pyridinyl)-N-[(2-methyl-3-phenylimidazol-4-yl)methyl]methanamine |
| SMILES | Cc1ncc(CNCc2ccnc(-n3ccnc3)c2)n1-c1ccccc1 |
| InChI | InChI=1S/C20H20N6/c1-16-24-14-19(26(16)18-5-3-2-4-6-18)13-22-12-17-7-8-23-20(11-17)25-10-9-21-15-25/h2-11,14-15,22H,12-13H2,1H3 |
| InChIKey | BUTZQJCXNVWKEG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |