About [1-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylamino]cyclopentyl]methanol
[1-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylamino]cyclopentyl]methanol (PubChem CID 71859800) has the molecular formula C15H21N3O
and a molecular weight of 259.35 g/mol. Its IUPAC name is [1-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylamino]cyclopentyl]methanol.
Molecular Properties
| Compound Name | [1-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylamino]cyclopentyl]methanol |
| PubChem CID | 71859800 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | [1-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylamino]cyclopentyl]methanol |
| SMILES | Cc1cccn2c(CNC3(CO)CCCC3)cnc12 |
| InChI | InChI=1S/C15H21N3O/c1-12-5-4-8-18-13(9-16-14(12)18)10-17-15(11-19)6-2-3-7-15/h4-5,8-9,17,19H,2-3,6-7,10-11H2,1H3 |
| InChIKey | WNVWQMWPSQLQDX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylamino]cyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylamino]cyclopentyl]methanol?
The IUPAC name of [1-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylamino]cyclopentyl]methanol (CID 71859800) is [1-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylamino]cyclopentyl]methanol.
What is the SMILES notation for [1-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylamino]cyclopentyl]methanol?
The canonical SMILES for [1-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylamino]cyclopentyl]methanol is Cc1cccn2c(CNC3(CO)CCCC3)cnc12.
What is the InChIKey of [1-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylamino]cyclopentyl]methanol?
The InChIKey is WNVWQMWPSQLQDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O/c1-12-5-4-8-18-13(9-16-14(12)18)10-17-15(11-19)6-2-3-7-15/h4-5,8-9,17,19H,2-3,6-7,10-11H2,1H3.
What are the key properties of [1-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylamino]cyclopentyl]methanol?
[1-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylamino]cyclopentyl]methanol has a molecular weight of 259.35 g/mol, XLogP of 2.04, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylamino]cyclopentyl]methanol is sourced from PubChem (CID 71859800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).