About 3-[2-[[1-(1,3-thiazol-2-yl)cyclopentyl]amino]ethyl]thieno[3,2-d]pyrimidin-4-one
3-[2-[[1-(1,3-thiazol-2-yl)cyclopentyl]amino]ethyl]thieno[3,2-d]pyrimidin-4-one (PubChem CID 71859872) has the molecular formula C16H18N4OS2
and a molecular weight of 346.48 g/mol. Its IUPAC name is 3-[2-[[1-(1,3-thiazol-2-yl)cyclopentyl]amino]ethyl]thieno[3,2-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-[2-[[1-(1,3-thiazol-2-yl)cyclopentyl]amino]ethyl]thieno[3,2-d]pyrimidin-4-one |
| PubChem CID | 71859872 |
| Molecular Formula | C16H18N4OS2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 3-[2-[[1-(1,3-thiazol-2-yl)cyclopentyl]amino]ethyl]thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=c1c2sccc2ncn1CCNC1(c2nccs2)CCCC1 |
| InChI | InChI=1S/C16H18N4OS2/c21-14-13-12(3-9-22-13)18-11-20(14)8-6-19-16(4-1-2-5-16)15-17-7-10-23-15/h3,7,9-11,19H,1-2,4-6,8H2 |
| InChIKey | ASYZXJYOFBPEGM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[2-[[1-(1,3-thiazol-2-yl)cyclopentyl]amino]ethyl]thieno[3,2-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[[1-(1,3-thiazol-2-yl)cyclopentyl]amino]ethyl]thieno[3,2-d]pyrimidin-4-one?
The IUPAC name of 3-[2-[[1-(1,3-thiazol-2-yl)cyclopentyl]amino]ethyl]thieno[3,2-d]pyrimidin-4-one (CID 71859872) is 3-[2-[[1-(1,3-thiazol-2-yl)cyclopentyl]amino]ethyl]thieno[3,2-d]pyrimidin-4-one.
What is the SMILES notation for 3-[2-[[1-(1,3-thiazol-2-yl)cyclopentyl]amino]ethyl]thieno[3,2-d]pyrimidin-4-one?
The canonical SMILES for 3-[2-[[1-(1,3-thiazol-2-yl)cyclopentyl]amino]ethyl]thieno[3,2-d]pyrimidin-4-one is O=c1c2sccc2ncn1CCNC1(c2nccs2)CCCC1.
What is the InChIKey of 3-[2-[[1-(1,3-thiazol-2-yl)cyclopentyl]amino]ethyl]thieno[3,2-d]pyrimidin-4-one?
The InChIKey is ASYZXJYOFBPEGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4OS2/c21-14-13-12(3-9-22-13)18-11-20(14)8-6-19-16(4-1-2-5-16)15-17-7-10-23-15/h3,7,9-11,19H,1-2,4-6,8H2.
What are the key properties of 3-[2-[[1-(1,3-thiazol-2-yl)cyclopentyl]amino]ethyl]thieno[3,2-d]pyrimidin-4-one?
3-[2-[[1-(1,3-thiazol-2-yl)cyclopentyl]amino]ethyl]thieno[3,2-d]pyrimidin-4-one has a molecular weight of 346.48 g/mol, XLogP of 2.97, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[[1-(1,3-thiazol-2-yl)cyclopentyl]amino]ethyl]thieno[3,2-d]pyrimidin-4-one is sourced from PubChem (CID 71859872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).