C18H26N6 — CID 71859877
6-[[2-(2,3-dimethylphenyl)pyrrolidin-1-yl]methyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 71859877) has the molecular formula C18H26N6 and a molecular weight of 326.45 g/mol. Its IUPAC name is 6-[[2-(2,3-dimethylphenyl)pyrrolidin-1-yl]methyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[[2-(2,3-dimethylphenyl)pyrrolidin-1-yl]methyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 71859877 |
| Molecular Formula | C18H26N6 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 6-[[2-(2,3-dimethylphenyl)pyrrolidin-1-yl]methyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1cccc(C2CCCN2Cc2nc(N)nc(N(C)C)n2)c1C |
| InChI | InChI=1S/C18H26N6/c1-12-7-5-8-14(13(12)2)15-9-6-10-24(15)11-16-20-17(19)22-18(21-16)23(3)4/h5,7-8,15H,6,9-11H2,1-4H3,(H2,19,20,21,22) |
| InChIKey | VNEBZBIUBKQSJC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |