About 5-methyl-N,N-bis[(6-methyl-2-pyridinyl)methyl]-1H-pyrazole-4-carboxamide
5-methyl-N,N-bis[(6-methyl-2-pyridinyl)methyl]-1H-pyrazole-4-carboxamide (PubChem CID 71860011) has the molecular formula C19H21N5O
and a molecular weight of 335.41 g/mol. Its IUPAC name is 5-methyl-N,N-bis[(6-methyl-2-pyridinyl)methyl]-1H-pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-methyl-N,N-bis[(6-methyl-2-pyridinyl)methyl]-1H-pyrazole-4-carboxamide |
| PubChem CID | 71860011 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 5-methyl-N,N-bis[(6-methyl-2-pyridinyl)methyl]-1H-pyrazole-4-carboxamide |
| SMILES | Cc1cccc(CN(Cc2cccc(C)n2)C(=O)c2cn[nH]c2C)n1 |
| InChI | InChI=1S/C19H21N5O/c1-13-6-4-8-16(21-13)11-24(12-17-9-5-7-14(2)22-17)19(25)18-10-20-23-15(18)3/h4-10H,11-12H2,1-3H3,(H,20,23) |
| InChIKey | HBMORBKAYIACHZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-N,N-bis[(6-methyl-2-pyridinyl)methyl]-1H-pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N,N-bis[(6-methyl-2-pyridinyl)methyl]-1H-pyrazole-4-carboxamide?
The IUPAC name of 5-methyl-N,N-bis[(6-methyl-2-pyridinyl)methyl]-1H-pyrazole-4-carboxamide (CID 71860011) is 5-methyl-N,N-bis[(6-methyl-2-pyridinyl)methyl]-1H-pyrazole-4-carboxamide.
What is the SMILES notation for 5-methyl-N,N-bis[(6-methyl-2-pyridinyl)methyl]-1H-pyrazole-4-carboxamide?
The canonical SMILES for 5-methyl-N,N-bis[(6-methyl-2-pyridinyl)methyl]-1H-pyrazole-4-carboxamide is Cc1cccc(CN(Cc2cccc(C)n2)C(=O)c2cn[nH]c2C)n1.
What is the InChIKey of 5-methyl-N,N-bis[(6-methyl-2-pyridinyl)methyl]-1H-pyrazole-4-carboxamide?
The InChIKey is HBMORBKAYIACHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N5O/c1-13-6-4-8-16(21-13)11-24(12-17-9-5-7-14(2)22-17)19(25)18-10-20-23-15(18)3/h4-10H,11-12H2,1-3H3,(H,20,23).
What are the key properties of 5-methyl-N,N-bis[(6-methyl-2-pyridinyl)methyl]-1H-pyrazole-4-carboxamide?
5-methyl-N,N-bis[(6-methyl-2-pyridinyl)methyl]-1H-pyrazole-4-carboxamide has a molecular weight of 335.41 g/mol, XLogP of 2.97, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N,N-bis[(6-methyl-2-pyridinyl)methyl]-1H-pyrazole-4-carboxamide is sourced from PubChem (CID 71860011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).