About 2-cyclopropyl-N-(2,5-dimethylpyrazol-3-yl)cyclopropane-1-carboxamide
2-cyclopropyl-N-(2,5-dimethylpyrazol-3-yl)cyclopropane-1-carboxamide (PubChem CID 71860336) has the molecular formula C12H17N3O
and a molecular weight of 219.29 g/mol. Its IUPAC name is 2-cyclopropyl-N-(2,5-dimethylpyrazol-3-yl)cyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | 2-cyclopropyl-N-(2,5-dimethylpyrazol-3-yl)cyclopropane-1-carboxamide |
| PubChem CID | 71860336 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 2-cyclopropyl-N-(2,5-dimethylpyrazol-3-yl)cyclopropane-1-carboxamide |
| SMILES | Cc1cc(NC(=O)C2CC2C2CC2)n(C)n1 |
| InChI | InChI=1S/C12H17N3O/c1-7-5-11(15(2)14-7)13-12(16)10-6-9(10)8-3-4-8/h5,8-10H,3-4,6H2,1-2H3,(H,13,16) |
| InChIKey | FUMOJAYKEPXAJJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopropyl-N-(2,5-dimethylpyrazol-3-yl)cyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-N-(2,5-dimethylpyrazol-3-yl)cyclopropane-1-carboxamide?
The IUPAC name of 2-cyclopropyl-N-(2,5-dimethylpyrazol-3-yl)cyclopropane-1-carboxamide (CID 71860336) is 2-cyclopropyl-N-(2,5-dimethylpyrazol-3-yl)cyclopropane-1-carboxamide.
What is the SMILES notation for 2-cyclopropyl-N-(2,5-dimethylpyrazol-3-yl)cyclopropane-1-carboxamide?
The canonical SMILES for 2-cyclopropyl-N-(2,5-dimethylpyrazol-3-yl)cyclopropane-1-carboxamide is Cc1cc(NC(=O)C2CC2C2CC2)n(C)n1.
What is the InChIKey of 2-cyclopropyl-N-(2,5-dimethylpyrazol-3-yl)cyclopropane-1-carboxamide?
The InChIKey is FUMOJAYKEPXAJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O/c1-7-5-11(15(2)14-7)13-12(16)10-6-9(10)8-3-4-8/h5,8-10H,3-4,6H2,1-2H3,(H,13,16).
What are the key properties of 2-cyclopropyl-N-(2,5-dimethylpyrazol-3-yl)cyclopropane-1-carboxamide?
2-cyclopropyl-N-(2,5-dimethylpyrazol-3-yl)cyclopropane-1-carboxamide has a molecular weight of 219.29 g/mol, XLogP of 1.71, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-N-(2,5-dimethylpyrazol-3-yl)cyclopropane-1-carboxamide is sourced from PubChem (CID 71860336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).