About 3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-(2-hydroxyethyl)amino]propan-1-ol
3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-(2-hydroxyethyl)amino]propan-1-ol (PubChem CID 71860365) has the molecular formula C10H17N3O3
and a molecular weight of 227.26 g/mol. Its IUPAC name is 3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-(2-hydroxyethyl)amino]propan-1-ol.
Molecular Properties
| Compound Name | 3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-(2-hydroxyethyl)amino]propan-1-ol |
| PubChem CID | 71860365 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-(2-hydroxyethyl)amino]propan-1-ol |
| SMILES | OCCCN(CCO)c1nc(C2CC2)no1 |
| InChI | InChI=1S/C10H17N3O3/c14-6-1-4-13(5-7-15)10-11-9(12-16-10)8-2-3-8/h8,14-15H,1-7H2 |
| InChIKey | IXBNCHBNMIVLRW-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-(2-hydroxyethyl)amino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-(2-hydroxyethyl)amino]propan-1-ol?
The IUPAC name of 3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-(2-hydroxyethyl)amino]propan-1-ol (CID 71860365) is 3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-(2-hydroxyethyl)amino]propan-1-ol.
What is the SMILES notation for 3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-(2-hydroxyethyl)amino]propan-1-ol?
The canonical SMILES for 3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-(2-hydroxyethyl)amino]propan-1-ol is OCCCN(CCO)c1nc(C2CC2)no1.
What is the InChIKey of 3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-(2-hydroxyethyl)amino]propan-1-ol?
The InChIKey is IXBNCHBNMIVLRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O3/c14-6-1-4-13(5-7-15)10-11-9(12-16-10)8-2-3-8/h8,14-15H,1-7H2.
What are the key properties of 3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-(2-hydroxyethyl)amino]propan-1-ol?
3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-(2-hydroxyethyl)amino]propan-1-ol has a molecular weight of 227.26 g/mol, XLogP of 0.13, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-(2-hydroxyethyl)amino]propan-1-ol is sourced from PubChem (CID 71860365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).