C13H21N3O2S2 — CID 71860556
4-(1-methylimidazol-4-yl)sulfonyl-1-thia-4-azaspiro[5.5]undecane (PubChem CID 71860556) has the molecular formula C13H21N3O2S2 and a molecular weight of 315.46 g/mol. Its IUPAC name is 4-(1-methylimidazol-4-yl)sulfonyl-1-thia-4-azaspiro[5.5]undecane.
| Compound Name | 4-(1-methylimidazol-4-yl)sulfonyl-1-thia-4-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 71860556 |
| Molecular Formula | C13H21N3O2S2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 4-(1-methylimidazol-4-yl)sulfonyl-1-thia-4-azaspiro[5.5]undecane |
| SMILES | Cn1cnc(S(=O)(=O)N2CCSC3(CCCCC3)C2)c1 |
| InChI | InChI=1S/C13H21N3O2S2/c1-15-9-12(14-11-15)20(17,18)16-7-8-19-13(10-16)5-3-2-4-6-13/h9,11H,2-8,10H2,1H3 |
| InChIKey | LMRRYDKXZWQUAM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |