About N-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methyl]-N-methyl-1,1-dioxothian-4-amine
N-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methyl]-N-methyl-1,1-dioxothian-4-amine (PubChem CID 71861028) has the molecular formula C14H18N2O3S2
and a molecular weight of 326.44 g/mol. Its IUPAC name is N-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methyl]-N-methyl-1,1-dioxothian-4-amine.
Molecular Properties
| Compound Name | N-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methyl]-N-methyl-1,1-dioxothian-4-amine |
| PubChem CID | 71861028 |
| Molecular Formula | C14H18N2O3S2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | N-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methyl]-N-methyl-1,1-dioxothian-4-amine |
| SMILES | CN(Cc1csc(-c2ccoc2)n1)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C14H18N2O3S2/c1-16(13-3-6-21(17,18)7-4-13)8-12-10-20-14(15-12)11-2-5-19-9-11/h2,5,9-10,13H,3-4,6-8H2,1H3 |
| InChIKey | GEIUNGARZXHTDT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methyl]-N-methyl-1,1-dioxothian-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methyl]-N-methyl-1,1-dioxothian-4-amine?
The IUPAC name of N-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methyl]-N-methyl-1,1-dioxothian-4-amine (CID 71861028) is N-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methyl]-N-methyl-1,1-dioxothian-4-amine.
What is the SMILES notation for N-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methyl]-N-methyl-1,1-dioxothian-4-amine?
The canonical SMILES for N-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methyl]-N-methyl-1,1-dioxothian-4-amine is CN(Cc1csc(-c2ccoc2)n1)C1CCS(=O)(=O)CC1.
What is the InChIKey of N-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methyl]-N-methyl-1,1-dioxothian-4-amine?
The InChIKey is GEIUNGARZXHTDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O3S2/c1-16(13-3-6-21(17,18)7-4-13)8-12-10-20-14(15-12)11-2-5-19-9-11/h2,5,9-10,13H,3-4,6-8H2,1H3.
What are the key properties of N-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methyl]-N-methyl-1,1-dioxothian-4-amine?
N-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methyl]-N-methyl-1,1-dioxothian-4-amine has a molecular weight of 326.44 g/mol, XLogP of 2.41, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methyl]-N-methyl-1,1-dioxothian-4-amine is sourced from PubChem (CID 71861028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).