About 1-(oxolan-3-yl)ethyl 5-cyclopropyl-2-phenyl-1,3-oxazole-4-carboxylate
1-(oxolan-3-yl)ethyl 5-cyclopropyl-2-phenyl-1,3-oxazole-4-carboxylate (PubChem CID 71861106) has the molecular formula C19H21NO4
and a molecular weight of 327.38 g/mol. Its IUPAC name is 1-(oxolan-3-yl)ethyl 5-cyclopropyl-2-phenyl-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | 1-(oxolan-3-yl)ethyl 5-cyclopropyl-2-phenyl-1,3-oxazole-4-carboxylate |
| PubChem CID | 71861106 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 1-(oxolan-3-yl)ethyl 5-cyclopropyl-2-phenyl-1,3-oxazole-4-carboxylate |
| SMILES | CC(OC(=O)c1nc(-c2ccccc2)oc1C1CC1)C1CCOC1 |
| InChI | InChI=1S/C19H21NO4/c1-12(15-9-10-22-11-15)23-19(21)16-17(13-7-8-13)24-18(20-16)14-5-3-2-4-6-14/h2-6,12-13,15H,7-11H2,1H3 |
| InChIKey | KTYIOTRWDSXYRC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(oxolan-3-yl)ethyl 5-cyclopropyl-2-phenyl-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxolan-3-yl)ethyl 5-cyclopropyl-2-phenyl-1,3-oxazole-4-carboxylate?
The IUPAC name of 1-(oxolan-3-yl)ethyl 5-cyclopropyl-2-phenyl-1,3-oxazole-4-carboxylate (CID 71861106) is 1-(oxolan-3-yl)ethyl 5-cyclopropyl-2-phenyl-1,3-oxazole-4-carboxylate.
What is the SMILES notation for 1-(oxolan-3-yl)ethyl 5-cyclopropyl-2-phenyl-1,3-oxazole-4-carboxylate?
The canonical SMILES for 1-(oxolan-3-yl)ethyl 5-cyclopropyl-2-phenyl-1,3-oxazole-4-carboxylate is CC(OC(=O)c1nc(-c2ccccc2)oc1C1CC1)C1CCOC1.
What is the InChIKey of 1-(oxolan-3-yl)ethyl 5-cyclopropyl-2-phenyl-1,3-oxazole-4-carboxylate?
The InChIKey is KTYIOTRWDSXYRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO4/c1-12(15-9-10-22-11-15)23-19(21)16-17(13-7-8-13)24-18(20-16)14-5-3-2-4-6-14/h2-6,12-13,15H,7-11H2,1H3.
What are the key properties of 1-(oxolan-3-yl)ethyl 5-cyclopropyl-2-phenyl-1,3-oxazole-4-carboxylate?
1-(oxolan-3-yl)ethyl 5-cyclopropyl-2-phenyl-1,3-oxazole-4-carboxylate has a molecular weight of 327.38 g/mol, XLogP of 3.80, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxolan-3-yl)ethyl 5-cyclopropyl-2-phenyl-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 71861106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).