About 5-[1-(3-nitroimidazo[1,2-a]pyridin-2-yl)piperidin-4-yl]-1H-pyrazol-3-amine
5-[1-(3-nitroimidazo[1,2-a]pyridin-2-yl)piperidin-4-yl]-1H-pyrazol-3-amine (PubChem CID 71861134) has the molecular formula C15H17N7O2
and a molecular weight of 327.35 g/mol. Its IUPAC name is 5-[1-(3-nitroimidazo[1,2-a]pyridin-2-yl)piperidin-4-yl]-1H-pyrazol-3-amine.
Molecular Properties
| Compound Name | 5-[1-(3-nitroimidazo[1,2-a]pyridin-2-yl)piperidin-4-yl]-1H-pyrazol-3-amine |
| PubChem CID | 71861134 |
| Molecular Formula | C15H17N7O2 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 5-[1-(3-nitroimidazo[1,2-a]pyridin-2-yl)piperidin-4-yl]-1H-pyrazol-3-amine |
| SMILES | Nc1cc(C2CCN(c3nc4ccccn4c3[N+](=O)[O-])CC2)[nH]n1 |
| InChI | InChI=1S/C15H17N7O2/c16-12-9-11(18-19-12)10-4-7-20(8-5-10)14-15(22(23)24)21-6-2-1-3-13(21)17-14/h1-3,6,9-10H,4-5,7-8H2,(H3,16,18,19) |
| InChIKey | LRRLONSMVYBOCE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[1-(3-nitroimidazo[1,2-a]pyridin-2-yl)piperidin-4-yl]-1H-pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(3-nitroimidazo[1,2-a]pyridin-2-yl)piperidin-4-yl]-1H-pyrazol-3-amine?
The IUPAC name of 5-[1-(3-nitroimidazo[1,2-a]pyridin-2-yl)piperidin-4-yl]-1H-pyrazol-3-amine (CID 71861134) is 5-[1-(3-nitroimidazo[1,2-a]pyridin-2-yl)piperidin-4-yl]-1H-pyrazol-3-amine.
What is the SMILES notation for 5-[1-(3-nitroimidazo[1,2-a]pyridin-2-yl)piperidin-4-yl]-1H-pyrazol-3-amine?
The canonical SMILES for 5-[1-(3-nitroimidazo[1,2-a]pyridin-2-yl)piperidin-4-yl]-1H-pyrazol-3-amine is Nc1cc(C2CCN(c3nc4ccccn4c3[N+](=O)[O-])CC2)[nH]n1.
What is the InChIKey of 5-[1-(3-nitroimidazo[1,2-a]pyridin-2-yl)piperidin-4-yl]-1H-pyrazol-3-amine?
The InChIKey is LRRLONSMVYBOCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N7O2/c16-12-9-11(18-19-12)10-4-7-20(8-5-10)14-15(22(23)24)21-6-2-1-3-13(21)17-14/h1-3,6,9-10H,4-5,7-8H2,(H3,16,18,19).
What are the key properties of 5-[1-(3-nitroimidazo[1,2-a]pyridin-2-yl)piperidin-4-yl]-1H-pyrazol-3-amine?
5-[1-(3-nitroimidazo[1,2-a]pyridin-2-yl)piperidin-4-yl]-1H-pyrazol-3-amine has a molecular weight of 327.35 g/mol, XLogP of 1.93, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(3-nitroimidazo[1,2-a]pyridin-2-yl)piperidin-4-yl]-1H-pyrazol-3-amine is sourced from PubChem (CID 71861134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).