C16H18FN3O3 — CID 71861217
N-(4-fluoro-3-pyrrol-1-ylphenyl)-2-(hydroxymethyl)morpholine-4-carboxamide (PubChem CID 71861217) has the molecular formula C16H18FN3O3 and a molecular weight of 319.34 g/mol. Its IUPAC name is N-(4-fluoro-3-pyrrol-1-ylphenyl)-2-(hydroxymethyl)morpholine-4-carboxamide.
| Compound Name | N-(4-fluoro-3-pyrrol-1-ylphenyl)-2-(hydroxymethyl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 71861217 |
| Molecular Formula | C16H18FN3O3 |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | N-(4-fluoro-3-pyrrol-1-ylphenyl)-2-(hydroxymethyl)morpholine-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(-n2cccc2)c1)N1CCOC(CO)C1 |
| InChI | InChI=1S/C16H18FN3O3/c17-14-4-3-12(9-15(14)19-5-1-2-6-19)18-16(22)20-7-8-23-13(10-20)11-21/h1-6,9,13,21H,7-8,10-11H2,(H,18,22) |
| InChIKey | DROXODDRZKBOJL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |