C12H16N2O2 — CID 71861401
1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl(1,2-oxazol-3-yl)methanone (PubChem CID 71861401) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl(1,2-oxazol-3-yl)methanone.
| Compound Name | 1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl(1,2-oxazol-3-yl)methanone |
|---|---|
| PubChem CID | 71861401 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl(1,2-oxazol-3-yl)methanone |
| SMILES | O=C(c1ccon1)N1CC2CCCCC2C1 |
| InChI | InChI=1S/C12H16N2O2/c15-12(11-5-6-16-13-11)14-7-9-3-1-2-4-10(9)8-14/h5-6,9-10H,1-4,7-8H2 |
| InChIKey | KDLABIXQMNWXMB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |