C15H16N6S — CID 71861524
3-ethyl-5-(3-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-1,2,4-thiadiazole (PubChem CID 71861524) has the molecular formula C15H16N6S and a molecular weight of 312.40 g/mol. Its IUPAC name is 3-ethyl-5-(3-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-1,2,4-thiadiazole.
| Compound Name | 3-ethyl-5-(3-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 71861524 |
| Molecular Formula | C15H16N6S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 3-ethyl-5-(3-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-1,2,4-thiadiazole |
| SMILES | CCc1nsc(N2CCn3c(nnc3-c3ccccc3)C2)n1 |
| InChI | InChI=1S/C15H16N6S/c1-2-12-16-15(22-19-12)20-8-9-21-13(10-20)17-18-14(21)11-6-4-3-5-7-11/h3-7H,2,8-10H2,1H3 |
| InChIKey | PDRRTXOYJDXICT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |