About N-(3-ethoxy-2,2-diethylcyclobutyl)oxolane-3-carboxamide
N-(3-ethoxy-2,2-diethylcyclobutyl)oxolane-3-carboxamide (PubChem CID 71862132) has the molecular formula C15H27NO3
and a molecular weight of 269.38 g/mol. Its IUPAC name is N-(3-ethoxy-2,2-diethylcyclobutyl)oxolane-3-carboxamide.
Molecular Properties
| Compound Name | N-(3-ethoxy-2,2-diethylcyclobutyl)oxolane-3-carboxamide |
| PubChem CID | 71862132 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | N-(3-ethoxy-2,2-diethylcyclobutyl)oxolane-3-carboxamide |
| SMILES | CCOC1CC(NC(=O)C2CCOC2)C1(CC)CC |
| InChI | InChI=1S/C15H27NO3/c1-4-15(5-2)12(9-13(15)19-6-3)16-14(17)11-7-8-18-10-11/h11-13H,4-10H2,1-3H3,(H,16,17) |
| InChIKey | UMVKLEQAVVKNJX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3-ethoxy-2,2-diethylcyclobutyl)oxolane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-ethoxy-2,2-diethylcyclobutyl)oxolane-3-carboxamide?
The IUPAC name of N-(3-ethoxy-2,2-diethylcyclobutyl)oxolane-3-carboxamide (CID 71862132) is N-(3-ethoxy-2,2-diethylcyclobutyl)oxolane-3-carboxamide.
What is the SMILES notation for N-(3-ethoxy-2,2-diethylcyclobutyl)oxolane-3-carboxamide?
The canonical SMILES for N-(3-ethoxy-2,2-diethylcyclobutyl)oxolane-3-carboxamide is CCOC1CC(NC(=O)C2CCOC2)C1(CC)CC.
What is the InChIKey of N-(3-ethoxy-2,2-diethylcyclobutyl)oxolane-3-carboxamide?
The InChIKey is UMVKLEQAVVKNJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO3/c1-4-15(5-2)12(9-13(15)19-6-3)16-14(17)11-7-8-18-10-11/h11-13H,4-10H2,1-3H3,(H,16,17).
What are the key properties of N-(3-ethoxy-2,2-diethylcyclobutyl)oxolane-3-carboxamide?
N-(3-ethoxy-2,2-diethylcyclobutyl)oxolane-3-carboxamide has a molecular weight of 269.38 g/mol, XLogP of 2.12, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-ethoxy-2,2-diethylcyclobutyl)oxolane-3-carboxamide is sourced from PubChem (CID 71862132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).