About [5-[(2-propyl-1,3-thiazol-4-yl)methoxy]-2-pyridinyl]methanol
[5-[(2-propyl-1,3-thiazol-4-yl)methoxy]-2-pyridinyl]methanol (PubChem CID 71862201) has the molecular formula C13H16N2O2S
and a molecular weight of 264.35 g/mol. Its IUPAC name is [5-[(2-propyl-1,3-thiazol-4-yl)methoxy]-2-pyridinyl]methanol.
Molecular Properties
| Compound Name | [5-[(2-propyl-1,3-thiazol-4-yl)methoxy]-2-pyridinyl]methanol |
| PubChem CID | 71862201 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | [5-[(2-propyl-1,3-thiazol-4-yl)methoxy]-2-pyridinyl]methanol |
| SMILES | CCCc1nc(COc2ccc(CO)nc2)cs1 |
| InChI | InChI=1S/C13H16N2O2S/c1-2-3-13-15-11(9-18-13)8-17-12-5-4-10(7-16)14-6-12/h4-6,9,16H,2-3,7-8H2,1H3 |
| InChIKey | YHBGYQIFNRCPMT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-[(2-propyl-1,3-thiazol-4-yl)methoxy]-2-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(2-propyl-1,3-thiazol-4-yl)methoxy]-2-pyridinyl]methanol?
The IUPAC name of [5-[(2-propyl-1,3-thiazol-4-yl)methoxy]-2-pyridinyl]methanol (CID 71862201) is [5-[(2-propyl-1,3-thiazol-4-yl)methoxy]-2-pyridinyl]methanol.
What is the SMILES notation for [5-[(2-propyl-1,3-thiazol-4-yl)methoxy]-2-pyridinyl]methanol?
The canonical SMILES for [5-[(2-propyl-1,3-thiazol-4-yl)methoxy]-2-pyridinyl]methanol is CCCc1nc(COc2ccc(CO)nc2)cs1.
What is the InChIKey of [5-[(2-propyl-1,3-thiazol-4-yl)methoxy]-2-pyridinyl]methanol?
The InChIKey is YHBGYQIFNRCPMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O2S/c1-2-3-13-15-11(9-18-13)8-17-12-5-4-10(7-16)14-6-12/h4-6,9,16H,2-3,7-8H2,1H3.
What are the key properties of [5-[(2-propyl-1,3-thiazol-4-yl)methoxy]-2-pyridinyl]methanol?
[5-[(2-propyl-1,3-thiazol-4-yl)methoxy]-2-pyridinyl]methanol has a molecular weight of 264.35 g/mol, XLogP of 2.56, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(2-propyl-1,3-thiazol-4-yl)methoxy]-2-pyridinyl]methanol is sourced from PubChem (CID 71862201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).