About 2-(1H-pyrazol-4-yl)ethyl butanoate
2-(1H-pyrazol-4-yl)ethyl butanoate (PubChem CID 71862250) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is 2-(1H-pyrazol-4-yl)ethyl butanoate.
Molecular Properties
| Compound Name | 2-(1H-pyrazol-4-yl)ethyl butanoate |
| PubChem CID | 71862250 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 2-(1H-pyrazol-4-yl)ethyl butanoate |
| SMILES | CCCC(=O)OCCc1cn[nH]c1 |
| InChI | InChI=1S/C9H14N2O2/c1-2-3-9(12)13-5-4-8-6-10-11-7-8/h6-7H,2-5H2,1H3,(H,10,11) |
| InChIKey | PFMNHYURBMMUTR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1H-pyrazol-4-yl)ethyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-pyrazol-4-yl)ethyl butanoate?
The IUPAC name of 2-(1H-pyrazol-4-yl)ethyl butanoate (CID 71862250) is 2-(1H-pyrazol-4-yl)ethyl butanoate.
What is the SMILES notation for 2-(1H-pyrazol-4-yl)ethyl butanoate?
The canonical SMILES for 2-(1H-pyrazol-4-yl)ethyl butanoate is CCCC(=O)OCCc1cn[nH]c1.
What is the InChIKey of 2-(1H-pyrazol-4-yl)ethyl butanoate?
The InChIKey is PFMNHYURBMMUTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c1-2-3-9(12)13-5-4-8-6-10-11-7-8/h6-7H,2-5H2,1H3,(H,10,11).
What are the key properties of 2-(1H-pyrazol-4-yl)ethyl butanoate?
2-(1H-pyrazol-4-yl)ethyl butanoate has a molecular weight of 182.22 g/mol, XLogP of 1.30, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-pyrazol-4-yl)ethyl butanoate is sourced from PubChem (CID 71862250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).