About 3-[1-(2,6-difluorophenyl)ethylsulfanyl]propane-1,2-diol
3-[1-(2,6-difluorophenyl)ethylsulfanyl]propane-1,2-diol (PubChem CID 71862759) has the molecular formula C11H14F2O2S
and a molecular weight of 248.29 g/mol. Its IUPAC name is 3-[1-(2,6-difluorophenyl)ethylsulfanyl]propane-1,2-diol.
Molecular Properties
| Compound Name | 3-[1-(2,6-difluorophenyl)ethylsulfanyl]propane-1,2-diol |
| PubChem CID | 71862759 |
| Molecular Formula | C11H14F2O2S |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 3-[1-(2,6-difluorophenyl)ethylsulfanyl]propane-1,2-diol |
| SMILES | CC(SCC(O)CO)c1c(F)cccc1F |
| InChI | InChI=1S/C11H14F2O2S/c1-7(16-6-8(15)5-14)11-9(12)3-2-4-10(11)13/h2-4,7-8,14-15H,5-6H2,1H3 |
| InChIKey | OAYPLTBJUMHENG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[1-(2,6-difluorophenyl)ethylsulfanyl]propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(2,6-difluorophenyl)ethylsulfanyl]propane-1,2-diol?
The IUPAC name of 3-[1-(2,6-difluorophenyl)ethylsulfanyl]propane-1,2-diol (CID 71862759) is 3-[1-(2,6-difluorophenyl)ethylsulfanyl]propane-1,2-diol.
What is the SMILES notation for 3-[1-(2,6-difluorophenyl)ethylsulfanyl]propane-1,2-diol?
The canonical SMILES for 3-[1-(2,6-difluorophenyl)ethylsulfanyl]propane-1,2-diol is CC(SCC(O)CO)c1c(F)cccc1F.
What is the InChIKey of 3-[1-(2,6-difluorophenyl)ethylsulfanyl]propane-1,2-diol?
The InChIKey is OAYPLTBJUMHENG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F2O2S/c1-7(16-6-8(15)5-14)11-9(12)3-2-4-10(11)13/h2-4,7-8,14-15H,5-6H2,1H3.
What are the key properties of 3-[1-(2,6-difluorophenyl)ethylsulfanyl]propane-1,2-diol?
3-[1-(2,6-difluorophenyl)ethylsulfanyl]propane-1,2-diol has a molecular weight of 248.29 g/mol, XLogP of 2.11, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2,6-difluorophenyl)ethylsulfanyl]propane-1,2-diol is sourced from PubChem (CID 71862759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).