C14H13ClF3N3O2 — CID 71862867
4-chloro-5-(1-hydroxypropan-2-ylamino)-2-[3-(trifluoromethyl)phenyl]pyridazin-3-one (PubChem CID 71862867) has the molecular formula C14H13ClF3N3O2 and a molecular weight of 347.72 g/mol. Its IUPAC name is 4-chloro-5-(1-hydroxypropan-2-ylamino)-2-[3-(trifluoromethyl)phenyl]pyridazin-3-one.
| Compound Name | 4-chloro-5-(1-hydroxypropan-2-ylamino)-2-[3-(trifluoromethyl)phenyl]pyridazin-3-one |
|---|---|
| PubChem CID | 71862867 |
| Molecular Formula | C14H13ClF3N3O2 |
| Molecular Weight | 347.72 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 4-chloro-5-(1-hydroxypropan-2-ylamino)-2-[3-(trifluoromethyl)phenyl]pyridazin-3-one |
| SMILES | CC(CO)Nc1cnn(-c2cccc(C(F)(F)F)c2)c(=O)c1Cl |
| InChI | InChI=1S/C14H13ClF3N3O2/c1-8(7-22)20-11-6-19-21(13(23)12(11)15)10-4-2-3-9(5-10)14(16,17)18/h2-6,8,20,22H,7H2,1H3 |
| InChIKey | PUDDQFRYHBFXRN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.72 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |