C17H28N2O4 — CID 71863554
methyl 5-(4-hydroxyhexylcarbamoyl)-2-methyl-4-propyl-1H-pyrrole-3-carboxylate (PubChem CID 71863554) has the molecular formula C17H28N2O4 and a molecular weight of 324.42 g/mol. Its IUPAC name is methyl 5-(4-hydroxyhexylcarbamoyl)-2-methyl-4-propyl-1H-pyrrole-3-carboxylate.
| Compound Name | methyl 5-(4-hydroxyhexylcarbamoyl)-2-methyl-4-propyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 71863554 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | methyl 5-(4-hydroxyhexylcarbamoyl)-2-methyl-4-propyl-1H-pyrrole-3-carboxylate |
| SMILES | CCCc1c(C(=O)NCCCC(O)CC)[nH]c(C)c1C(=O)OC |
| InChI | InChI=1S/C17H28N2O4/c1-5-8-13-14(17(22)23-4)11(3)19-15(13)16(21)18-10-7-9-12(20)6-2/h12,19-20H,5-10H2,1-4H3,(H,18,21) |
| InChIKey | YZVCVRCQVCHHMC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|