C22H20N2O5 — CID 71863645
[2-oxo-2-(2-phenoxyanilino)ethyl] 3-amino-4-methoxybenzoate (PubChem CID 71863645) has the molecular formula C22H20N2O5 and a molecular weight of 392.41 g/mol. Its IUPAC name is [2-oxo-2-(2-phenoxyanilino)ethyl] 3-amino-4-methoxybenzoate.
| Compound Name | [2-oxo-2-(2-phenoxyanilino)ethyl] 3-amino-4-methoxybenzoate |
|---|---|
| PubChem CID | 71863645 |
| Molecular Formula | C22H20N2O5 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | [2-oxo-2-(2-phenoxyanilino)ethyl] 3-amino-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)Nc2ccccc2Oc2ccccc2)cc1N |
| InChI | InChI=1S/C22H20N2O5/c1-27-19-12-11-15(13-17(19)23)22(26)28-14-21(25)24-18-9-5-6-10-20(18)29-16-7-3-2-4-8-16/h2-13H,14,23H2,1H3,(H,24,25) |
| InChIKey | YEWVMOMMDBFBQZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|