C15H16N6O3 — CID 71863898
N-[5-cyano-2-(propylamino)phenyl]-5-methyl-4-nitro-1H-pyrazole-3-carboxamide (PubChem CID 71863898) has the molecular formula C15H16N6O3 and a molecular weight of 328.33 g/mol. Its IUPAC name is N-[5-cyano-2-(propylamino)phenyl]-5-methyl-4-nitro-1H-pyrazole-3-carboxamide.
| Compound Name | N-[5-cyano-2-(propylamino)phenyl]-5-methyl-4-nitro-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 71863898 |
| Molecular Formula | C15H16N6O3 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | N-[5-cyano-2-(propylamino)phenyl]-5-methyl-4-nitro-1H-pyrazole-3-carboxamide |
| SMILES | CCCNc1ccc(C#N)cc1NC(=O)c1n[nH]c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H16N6O3/c1-3-6-17-11-5-4-10(8-16)7-12(11)18-15(22)13-14(21(23)24)9(2)19-20-13/h4-5,7,17H,3,6H2,1-2H3,(H,18,22)(H,19,20) |
| InChIKey | LHNCVANDHPDRLH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 136.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|