C16H28N2O4 — CID 71864037
tert-butyl 4-[2-[(3S)-3-hydroxypyrrolidin-1-yl]-2-oxoethyl]piperidine-1-carboxylate (PubChem CID 71864037) has the molecular formula C16H28N2O4 and a molecular weight of 312.41 g/mol. Its IUPAC name is tert-butyl 4-[2-[(3S)-3-hydroxypyrrolidin-1-yl]-2-oxoethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(3S)-3-hydroxypyrrolidin-1-yl]-2-oxoethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71864037 |
| Molecular Formula | C16H28N2O4 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | tert-butyl 4-[2-[(3S)-3-hydroxypyrrolidin-1-yl]-2-oxoethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC(=O)N2CC[C@H](O)C2)CC1 |
| InChI | InChI=1S/C16H28N2O4/c1-16(2,3)22-15(21)17-7-4-12(5-8-17)10-14(20)18-9-6-13(19)11-18/h12-13,19H,4-11H2,1-3H3/t13-/m0/s1 |
| InChIKey | VBGSYQFXAOKQCP-ZDUSSCGKSA-N |
| XLogP | 1.62 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |