C20H19N3O2S — CID 71864177
N-(1-oxothiolan-3-yl)-3-(5-phenylpyrazol-1-yl)benzamide (PubChem CID 71864177) has the molecular formula C20H19N3O2S and a molecular weight of 365.46 g/mol. Its IUPAC name is N-(1-oxothiolan-3-yl)-3-(5-phenylpyrazol-1-yl)benzamide.
| Compound Name | N-(1-oxothiolan-3-yl)-3-(5-phenylpyrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 71864177 |
| Molecular Formula | C20H19N3O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | N-(1-oxothiolan-3-yl)-3-(5-phenylpyrazol-1-yl)benzamide |
| SMILES | O=C(NC1CCS(=O)C1)c1cccc(-n2nccc2-c2ccccc2)c1 |
| InChI | InChI=1S/C20H19N3O2S/c24-20(22-17-10-12-26(25)14-17)16-7-4-8-18(13-16)23-19(9-11-21-23)15-5-2-1-3-6-15/h1-9,11,13,17H,10,12,14H2,(H,22,24) |
| InChIKey | ZWRQOPZYNLKZEV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |