C12H12F3N5OS — CID 71864258
1-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-(3,4,5-trifluorophenyl)urea (PubChem CID 71864258) has the molecular formula C12H12F3N5OS and a molecular weight of 331.32 g/mol. Its IUPAC name is 1-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-(3,4,5-trifluorophenyl)urea.
| Compound Name | 1-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-(3,4,5-trifluorophenyl)urea |
|---|---|
| PubChem CID | 71864258 |
| Molecular Formula | C12H12F3N5OS |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 1-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-(3,4,5-trifluorophenyl)urea |
| SMILES | CCn1c(CNC(=O)Nc2cc(F)c(F)c(F)c2)n[nH]c1=S |
| InChI | InChI=1S/C12H12F3N5OS/c1-2-20-9(18-19-12(20)22)5-16-11(21)17-6-3-7(13)10(15)8(14)4-6/h3-4H,2,5H2,1H3,(H,19,22)(H2,16,17,21) |
| InChIKey | ISTJCYUMXBMFOO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|