C18H22N4O2 — CID 71864264
1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[4-[(4-methylpyrazol-1-yl)methyl]phenyl]urea (PubChem CID 71864264) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[4-[(4-methylpyrazol-1-yl)methyl]phenyl]urea.
| Compound Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[4-[(4-methylpyrazol-1-yl)methyl]phenyl]urea |
|---|---|
| PubChem CID | 71864264 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[4-[(4-methylpyrazol-1-yl)methyl]phenyl]urea |
| SMILES | Cc1cnn(Cc2ccc(NC(=O)N[C@@H]3C=C[C@H](CO)C3)cc2)c1 |
| InChI | InChI=1S/C18H22N4O2/c1-13-9-19-22(10-13)11-14-2-5-16(6-3-14)20-18(24)21-17-7-4-15(8-17)12-23/h2-7,9-10,15,17,23H,8,11-12H2,1H3,(H2,20,21,24)/t15-,17+/m0/s1 |
| InChIKey | ZBYSDLOMOQIFMH-DOTOQJQBSA-N |
| XLogP | 2.30 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|