About N'-(3,5-dichloro-2-pyridinyl)-N-[(1-methylimidazol-2-yl)methyl]ethane-1,2-diamine
N'-(3,5-dichloro-2-pyridinyl)-N-[(1-methylimidazol-2-yl)methyl]ethane-1,2-diamine (PubChem CID 71864686) has the molecular formula C12H15Cl2N5
and a molecular weight of 300.19 g/mol. Its IUPAC name is N'-(3,5-dichloro-2-pyridinyl)-N-[(1-methylimidazol-2-yl)methyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(3,5-dichloro-2-pyridinyl)-N-[(1-methylimidazol-2-yl)methyl]ethane-1,2-diamine |
| PubChem CID | 71864686 |
| Molecular Formula | C12H15Cl2N5 |
| Molecular Weight | 300.19 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | N'-(3,5-dichloro-2-pyridinyl)-N-[(1-methylimidazol-2-yl)methyl]ethane-1,2-diamine |
| SMILES | Cn1ccnc1CNCCNc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C12H15Cl2N5/c1-19-5-4-16-11(19)8-15-2-3-17-12-10(14)6-9(13)7-18-12/h4-7,15H,2-3,8H2,1H3,(H,17,18) |
| InChIKey | HDEHRCDFGCJUIO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.19 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(3,5-dichloro-2-pyridinyl)-N-[(1-methylimidazol-2-yl)methyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3,5-dichloro-2-pyridinyl)-N-[(1-methylimidazol-2-yl)methyl]ethane-1,2-diamine?
The IUPAC name of N'-(3,5-dichloro-2-pyridinyl)-N-[(1-methylimidazol-2-yl)methyl]ethane-1,2-diamine (CID 71864686) is N'-(3,5-dichloro-2-pyridinyl)-N-[(1-methylimidazol-2-yl)methyl]ethane-1,2-diamine.
What is the SMILES notation for N'-(3,5-dichloro-2-pyridinyl)-N-[(1-methylimidazol-2-yl)methyl]ethane-1,2-diamine?
The canonical SMILES for N'-(3,5-dichloro-2-pyridinyl)-N-[(1-methylimidazol-2-yl)methyl]ethane-1,2-diamine is Cn1ccnc1CNCCNc1ncc(Cl)cc1Cl.
What is the InChIKey of N'-(3,5-dichloro-2-pyridinyl)-N-[(1-methylimidazol-2-yl)methyl]ethane-1,2-diamine?
The InChIKey is HDEHRCDFGCJUIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15Cl2N5/c1-19-5-4-16-11(19)8-15-2-3-17-12-10(14)6-9(13)7-18-12/h4-7,15H,2-3,8H2,1H3,(H,17,18).
What are the key properties of N'-(3,5-dichloro-2-pyridinyl)-N-[(1-methylimidazol-2-yl)methyl]ethane-1,2-diamine?
N'-(3,5-dichloro-2-pyridinyl)-N-[(1-methylimidazol-2-yl)methyl]ethane-1,2-diamine has a molecular weight of 300.19 g/mol, XLogP of 2.32, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3,5-dichloro-2-pyridinyl)-N-[(1-methylimidazol-2-yl)methyl]ethane-1,2-diamine is sourced from PubChem (CID 71864686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).