About 3-fluoro-4-[[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]benzonitrile
3-fluoro-4-[[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]benzonitrile (PubChem CID 71865387) has the molecular formula C16H13FN2O
and a molecular weight of 268.29 g/mol. Its IUPAC name is 3-fluoro-4-[[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]benzonitrile.
Molecular Properties
| Compound Name | 3-fluoro-4-[[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]benzonitrile |
| PubChem CID | 71865387 |
| Molecular Formula | C16H13FN2O |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 3-fluoro-4-[[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]benzonitrile |
| SMILES | N#Cc1ccc(N[C@@H]2c3ccccc3C[C@@H]2O)c(F)c1 |
| InChI | InChI=1S/C16H13FN2O/c17-13-7-10(9-18)5-6-14(13)19-16-12-4-2-1-3-11(12)8-15(16)20/h1-7,15-16,19-20H,8H2/t15-,16+/m0/s1 |
| InChIKey | BNAYPENAHBXGKM-JKSUJKDBSA-N |
| XLogP | 2.77 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-fluoro-4-[[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4-[[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]benzonitrile?
The IUPAC name of 3-fluoro-4-[[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]benzonitrile (CID 71865387) is 3-fluoro-4-[[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]benzonitrile.
What is the SMILES notation for 3-fluoro-4-[[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]benzonitrile?
The canonical SMILES for 3-fluoro-4-[[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]benzonitrile is N#Cc1ccc(N[C@@H]2c3ccccc3C[C@@H]2O)c(F)c1.
What is the InChIKey of 3-fluoro-4-[[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]benzonitrile?
The InChIKey is BNAYPENAHBXGKM-JKSUJKDBSA-N. The full InChI is InChI=1S/C16H13FN2O/c17-13-7-10(9-18)5-6-14(13)19-16-12-4-2-1-3-11(12)8-15(16)20/h1-7,15-16,19-20H,8H2/t15-,16+/m0/s1.
What are the key properties of 3-fluoro-4-[[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]benzonitrile?
3-fluoro-4-[[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]benzonitrile has a molecular weight of 268.29 g/mol, XLogP of 2.77, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-[[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]benzonitrile is sourced from PubChem (CID 71865387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).