About (1,1-dioxothiolan-3-yl) 2-(3-methylcyclohexyl)acetate
(1,1-dioxothiolan-3-yl) 2-(3-methylcyclohexyl)acetate (PubChem CID 71865491) has the molecular formula C13H22O4S
and a molecular weight of 274.38 g/mol. Its IUPAC name is (1,1-dioxothiolan-3-yl) 2-(3-methylcyclohexyl)acetate.
Molecular Properties
| Compound Name | (1,1-dioxothiolan-3-yl) 2-(3-methylcyclohexyl)acetate |
| PubChem CID | 71865491 |
| Molecular Formula | C13H22O4S |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | (1,1-dioxothiolan-3-yl) 2-(3-methylcyclohexyl)acetate |
| SMILES | CC1CCCC(CC(=O)OC2CCS(=O)(=O)C2)C1 |
| InChI | InChI=1S/C13H22O4S/c1-10-3-2-4-11(7-10)8-13(14)17-12-5-6-18(15,16)9-12/h10-12H,2-9H2,1H3 |
| InChIKey | GPQQGQISJMNCEN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1,1-dioxothiolan-3-yl) 2-(3-methylcyclohexyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,1-dioxothiolan-3-yl) 2-(3-methylcyclohexyl)acetate?
The IUPAC name of (1,1-dioxothiolan-3-yl) 2-(3-methylcyclohexyl)acetate (CID 71865491) is (1,1-dioxothiolan-3-yl) 2-(3-methylcyclohexyl)acetate.
What is the SMILES notation for (1,1-dioxothiolan-3-yl) 2-(3-methylcyclohexyl)acetate?
The canonical SMILES for (1,1-dioxothiolan-3-yl) 2-(3-methylcyclohexyl)acetate is CC1CCCC(CC(=O)OC2CCS(=O)(=O)C2)C1.
What is the InChIKey of (1,1-dioxothiolan-3-yl) 2-(3-methylcyclohexyl)acetate?
The InChIKey is GPQQGQISJMNCEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O4S/c1-10-3-2-4-11(7-10)8-13(14)17-12-5-6-18(15,16)9-12/h10-12H,2-9H2,1H3.
What are the key properties of (1,1-dioxothiolan-3-yl) 2-(3-methylcyclohexyl)acetate?
(1,1-dioxothiolan-3-yl) 2-(3-methylcyclohexyl)acetate has a molecular weight of 274.38 g/mol, XLogP of 1.93, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1,1-dioxothiolan-3-yl) 2-(3-methylcyclohexyl)acetate is sourced from PubChem (CID 71865491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).