About 1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-[1-(furan-2-yl)-2-methoxyethyl]urea
1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-[1-(furan-2-yl)-2-methoxyethyl]urea (PubChem CID 71865664) has the molecular formula C14H19N3O3S
and a molecular weight of 309.39 g/mol. Its IUPAC name is 1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-[1-(furan-2-yl)-2-methoxyethyl]urea.
Molecular Properties
| Compound Name | 1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-[1-(furan-2-yl)-2-methoxyethyl]urea |
| PubChem CID | 71865664 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-[1-(furan-2-yl)-2-methoxyethyl]urea |
| SMILES | COCC(NC(=O)NCc1sc(C)nc1C)c1ccco1 |
| InChI | InChI=1S/C14H19N3O3S/c1-9-13(21-10(2)16-9)7-15-14(18)17-11(8-19-3)12-5-4-6-20-12/h4-6,11H,7-8H2,1-3H3,(H2,15,17,18) |
| InChIKey | HNEBPGVSXCWECS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-[1-(furan-2-yl)-2-methoxyethyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-[1-(furan-2-yl)-2-methoxyethyl]urea?
The IUPAC name of 1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-[1-(furan-2-yl)-2-methoxyethyl]urea (CID 71865664) is 1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-[1-(furan-2-yl)-2-methoxyethyl]urea.
What is the SMILES notation for 1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-[1-(furan-2-yl)-2-methoxyethyl]urea?
The canonical SMILES for 1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-[1-(furan-2-yl)-2-methoxyethyl]urea is COCC(NC(=O)NCc1sc(C)nc1C)c1ccco1.
What is the InChIKey of 1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-[1-(furan-2-yl)-2-methoxyethyl]urea?
The InChIKey is HNEBPGVSXCWECS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O3S/c1-9-13(21-10(2)16-9)7-15-14(18)17-11(8-19-3)12-5-4-6-20-12/h4-6,11H,7-8H2,1-3H3,(H2,15,17,18).
What are the key properties of 1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-[1-(furan-2-yl)-2-methoxyethyl]urea?
1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-[1-(furan-2-yl)-2-methoxyethyl]urea has a molecular weight of 309.39 g/mol, XLogP of 2.54, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-[1-(furan-2-yl)-2-methoxyethyl]urea is sourced from PubChem (CID 71865664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).