C15H15F2N5O2 — CID 71865950
3-(2,5-difluorophenyl)-N-[2-(3-methyl-1,2,4-triazol-4-yl)ethyl]-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 71865950) has the molecular formula C15H15F2N5O2 and a molecular weight of 335.31 g/mol. Its IUPAC name is 3-(2,5-difluorophenyl)-N-[2-(3-methyl-1,2,4-triazol-4-yl)ethyl]-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | 3-(2,5-difluorophenyl)-N-[2-(3-methyl-1,2,4-triazol-4-yl)ethyl]-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 71865950 |
| Molecular Formula | C15H15F2N5O2 |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 3-(2,5-difluorophenyl)-N-[2-(3-methyl-1,2,4-triazol-4-yl)ethyl]-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | Cc1nncn1CCNC(=O)C1CC(c2cc(F)ccc2F)=NO1 |
| InChI | InChI=1S/C15H15F2N5O2/c1-9-20-19-8-22(9)5-4-18-15(23)14-7-13(21-24-14)11-6-10(16)2-3-12(11)17/h2-3,6,8,14H,4-5,7H2,1H3,(H,18,23) |
| InChIKey | NBLMUIRQSIYBGT-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |