About 3-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methyl-(cyclopropylmethyl)amino]propanenitrile
3-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methyl-(cyclopropylmethyl)amino]propanenitrile (PubChem CID 71866245) has the molecular formula C17H18ClN3O
and a molecular weight of 315.80 g/mol. Its IUPAC name is 3-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methyl-(cyclopropylmethyl)amino]propanenitrile.
Molecular Properties
| Compound Name | 3-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methyl-(cyclopropylmethyl)amino]propanenitrile |
| PubChem CID | 71866245 |
| Molecular Formula | C17H18ClN3O |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 3-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methyl-(cyclopropylmethyl)amino]propanenitrile |
| SMILES | N#CCCN(Cc1ncc(-c2ccccc2Cl)o1)CC1CC1 |
| InChI | InChI=1S/C17H18ClN3O/c18-15-5-2-1-4-14(15)16-10-20-17(22-16)12-21(9-3-8-19)11-13-6-7-13/h1-2,4-5,10,13H,3,6-7,9,11-12H2 |
| InChIKey | CHYGGNKPRQHIGE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 53.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methyl-(cyclopropylmethyl)amino]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methyl-(cyclopropylmethyl)amino]propanenitrile?
The IUPAC name of 3-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methyl-(cyclopropylmethyl)amino]propanenitrile (CID 71866245) is 3-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methyl-(cyclopropylmethyl)amino]propanenitrile.
What is the SMILES notation for 3-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methyl-(cyclopropylmethyl)amino]propanenitrile?
The canonical SMILES for 3-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methyl-(cyclopropylmethyl)amino]propanenitrile is N#CCCN(Cc1ncc(-c2ccccc2Cl)o1)CC1CC1.
What is the InChIKey of 3-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methyl-(cyclopropylmethyl)amino]propanenitrile?
The InChIKey is CHYGGNKPRQHIGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18ClN3O/c18-15-5-2-1-4-14(15)16-10-20-17(22-16)12-21(9-3-8-19)11-13-6-7-13/h1-2,4-5,10,13H,3,6-7,9,11-12H2.
What are the key properties of 3-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methyl-(cyclopropylmethyl)amino]propanenitrile?
3-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methyl-(cyclopropylmethyl)amino]propanenitrile has a molecular weight of 315.80 g/mol, XLogP of 4.12, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methyl-(cyclopropylmethyl)amino]propanenitrile is sourced from PubChem (CID 71866245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).