C14H13F2N7O — CID 71867165
1-[1-(2,2-difluoroethyl)pyrazol-4-yl]-3-[4-(triazol-2-yl)phenyl]urea (PubChem CID 71867165) has the molecular formula C14H13F2N7O and a molecular weight of 333.30 g/mol. Its IUPAC name is 1-[1-(2,2-difluoroethyl)pyrazol-4-yl]-3-[4-(triazol-2-yl)phenyl]urea.
| Compound Name | 1-[1-(2,2-difluoroethyl)pyrazol-4-yl]-3-[4-(triazol-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 71867165 |
| Molecular Formula | C14H13F2N7O |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 1-[1-(2,2-difluoroethyl)pyrazol-4-yl]-3-[4-(triazol-2-yl)phenyl]urea |
| SMILES | O=C(Nc1ccc(-n2nccn2)cc1)Nc1cnn(CC(F)F)c1 |
| InChI | InChI=1S/C14H13F2N7O/c15-13(16)9-22-8-11(7-19-22)21-14(24)20-10-1-3-12(4-2-10)23-17-5-6-18-23/h1-8,13H,9H2,(H2,20,21,24) |
| InChIKey | SXPUGFIZHRJXJN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |