About 4-benzyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]piperazine-1-carboxamide
4-benzyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]piperazine-1-carboxamide (PubChem CID 71867641) has the molecular formula C18H26N6O
and a molecular weight of 342.45 g/mol. Its IUPAC name is 4-benzyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]piperazine-1-carboxamide.
Molecular Properties
| Compound Name | 4-benzyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]piperazine-1-carboxamide |
| PubChem CID | 71867641 |
| Molecular Formula | C18H26N6O |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 4-benzyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]piperazine-1-carboxamide |
| SMILES | CCc1nncn1CCNC(=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H26N6O/c1-2-17-21-20-15-24(17)9-8-19-18(25)23-12-10-22(11-13-23)14-16-6-4-3-5-7-16/h3-7,15H,2,8-14H2,1H3,(H,19,25) |
| InChIKey | GDMCUVMLCOTYQX-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-benzyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]piperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]piperazine-1-carboxamide?
The IUPAC name of 4-benzyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]piperazine-1-carboxamide (CID 71867641) is 4-benzyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]piperazine-1-carboxamide.
What is the SMILES notation for 4-benzyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]piperazine-1-carboxamide?
The canonical SMILES for 4-benzyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]piperazine-1-carboxamide is CCc1nncn1CCNC(=O)N1CCN(Cc2ccccc2)CC1.
What is the InChIKey of 4-benzyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]piperazine-1-carboxamide?
The InChIKey is GDMCUVMLCOTYQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N6O/c1-2-17-21-20-15-24(17)9-8-19-18(25)23-12-10-22(11-13-23)14-16-6-4-3-5-7-16/h3-7,15H,2,8-14H2,1H3,(H,19,25).
What are the key properties of 4-benzyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]piperazine-1-carboxamide?
4-benzyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]piperazine-1-carboxamide has a molecular weight of 342.45 g/mol, XLogP of 1.37, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]piperazine-1-carboxamide is sourced from PubChem (CID 71867641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).