About N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-(hydroxymethyl)piperidine-1-carboxamide
N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-(hydroxymethyl)piperidine-1-carboxamide (PubChem CID 71867686) has the molecular formula C14H23N3O2S
and a molecular weight of 297.42 g/mol. Its IUPAC name is N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-(hydroxymethyl)piperidine-1-carboxamide.
Molecular Properties
| Compound Name | N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-(hydroxymethyl)piperidine-1-carboxamide |
| PubChem CID | 71867686 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-(hydroxymethyl)piperidine-1-carboxamide |
| SMILES | CCc1cnc(CCNC(=O)N2CCCC(CO)C2)s1 |
| InChI | InChI=1S/C14H23N3O2S/c1-2-12-8-16-13(20-12)5-6-15-14(19)17-7-3-4-11(9-17)10-18/h8,11,18H,2-7,9-10H2,1H3,(H,15,19) |
| InChIKey | LKJNLOYKFQLNMU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-(hydroxymethyl)piperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-(hydroxymethyl)piperidine-1-carboxamide?
The IUPAC name of N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-(hydroxymethyl)piperidine-1-carboxamide (CID 71867686) is N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-(hydroxymethyl)piperidine-1-carboxamide.
What is the SMILES notation for N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-(hydroxymethyl)piperidine-1-carboxamide?
The canonical SMILES for N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-(hydroxymethyl)piperidine-1-carboxamide is CCc1cnc(CCNC(=O)N2CCCC(CO)C2)s1.
What is the InChIKey of N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-(hydroxymethyl)piperidine-1-carboxamide?
The InChIKey is LKJNLOYKFQLNMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O2S/c1-2-12-8-16-13(20-12)5-6-15-14(19)17-7-3-4-11(9-17)10-18/h8,11,18H,2-7,9-10H2,1H3,(H,15,19).
What are the key properties of N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-(hydroxymethyl)piperidine-1-carboxamide?
N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-(hydroxymethyl)piperidine-1-carboxamide has a molecular weight of 297.42 g/mol, XLogP of 1.66, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-(hydroxymethyl)piperidine-1-carboxamide is sourced from PubChem (CID 71867686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).