C15H18N4O3S — CID 71867773
1-[2-(2-nitrophenyl)ethyl]-3-[2-(1,3-thiazol-2-yl)propan-2-yl]urea (PubChem CID 71867773) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is 1-[2-(2-nitrophenyl)ethyl]-3-[2-(1,3-thiazol-2-yl)propan-2-yl]urea.
| Compound Name | 1-[2-(2-nitrophenyl)ethyl]-3-[2-(1,3-thiazol-2-yl)propan-2-yl]urea |
|---|---|
| PubChem CID | 71867773 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 1-[2-(2-nitrophenyl)ethyl]-3-[2-(1,3-thiazol-2-yl)propan-2-yl]urea |
| SMILES | CC(C)(NC(=O)NCCc1ccccc1[N+](=O)[O-])c1nccs1 |
| InChI | InChI=1S/C15H18N4O3S/c1-15(2,13-16-9-10-23-13)18-14(20)17-8-7-11-5-3-4-6-12(11)19(21)22/h3-6,9-10H,7-8H2,1-2H3,(H2,17,18,20) |
| InChIKey | WSIXSCXKCRSBCQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|