About 1-[1-(3-cyclohexyl-1,2,4-oxadiazol-5-yl)ethyl]-3-[1-(1-methylpyrazol-4-yl)ethyl]urea
1-[1-(3-cyclohexyl-1,2,4-oxadiazol-5-yl)ethyl]-3-[1-(1-methylpyrazol-4-yl)ethyl]urea (PubChem CID 71868107) has the molecular formula C17H26N6O2
and a molecular weight of 346.44 g/mol. Its IUPAC name is 1-[1-(3-cyclohexyl-1,2,4-oxadiazol-5-yl)ethyl]-3-[1-(1-methylpyrazol-4-yl)ethyl]urea.
Molecular Properties
| Compound Name | 1-[1-(3-cyclohexyl-1,2,4-oxadiazol-5-yl)ethyl]-3-[1-(1-methylpyrazol-4-yl)ethyl]urea |
| PubChem CID | 71868107 |
| Molecular Formula | C17H26N6O2 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 1-[1-(3-cyclohexyl-1,2,4-oxadiazol-5-yl)ethyl]-3-[1-(1-methylpyrazol-4-yl)ethyl]urea |
| SMILES | CC(NC(=O)NC(C)c1nc(C2CCCCC2)no1)c1cnn(C)c1 |
| InChI | InChI=1S/C17H26N6O2/c1-11(14-9-18-23(3)10-14)19-17(24)20-12(2)16-21-15(22-25-16)13-7-5-4-6-8-13/h9-13H,4-8H2,1-3H3,(H2,19,20,24) |
| InChIKey | UOKRYZLZLDBBSR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 97.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[1-(3-cyclohexyl-1,2,4-oxadiazol-5-yl)ethyl]-3-[1-(1-methylpyrazol-4-yl)ethyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(3-cyclohexyl-1,2,4-oxadiazol-5-yl)ethyl]-3-[1-(1-methylpyrazol-4-yl)ethyl]urea?
The IUPAC name of 1-[1-(3-cyclohexyl-1,2,4-oxadiazol-5-yl)ethyl]-3-[1-(1-methylpyrazol-4-yl)ethyl]urea (CID 71868107) is 1-[1-(3-cyclohexyl-1,2,4-oxadiazol-5-yl)ethyl]-3-[1-(1-methylpyrazol-4-yl)ethyl]urea.
What is the SMILES notation for 1-[1-(3-cyclohexyl-1,2,4-oxadiazol-5-yl)ethyl]-3-[1-(1-methylpyrazol-4-yl)ethyl]urea?
The canonical SMILES for 1-[1-(3-cyclohexyl-1,2,4-oxadiazol-5-yl)ethyl]-3-[1-(1-methylpyrazol-4-yl)ethyl]urea is CC(NC(=O)NC(C)c1nc(C2CCCCC2)no1)c1cnn(C)c1.
What is the InChIKey of 1-[1-(3-cyclohexyl-1,2,4-oxadiazol-5-yl)ethyl]-3-[1-(1-methylpyrazol-4-yl)ethyl]urea?
The InChIKey is UOKRYZLZLDBBSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N6O2/c1-11(14-9-18-23(3)10-14)19-17(24)20-12(2)16-21-15(22-25-16)13-7-5-4-6-8-13/h9-13H,4-8H2,1-3H3,(H2,19,20,24).
What are the key properties of 1-[1-(3-cyclohexyl-1,2,4-oxadiazol-5-yl)ethyl]-3-[1-(1-methylpyrazol-4-yl)ethyl]urea?
1-[1-(3-cyclohexyl-1,2,4-oxadiazol-5-yl)ethyl]-3-[1-(1-methylpyrazol-4-yl)ethyl]urea has a molecular weight of 346.44 g/mol, XLogP of 2.97, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(3-cyclohexyl-1,2,4-oxadiazol-5-yl)ethyl]-3-[1-(1-methylpyrazol-4-yl)ethyl]urea is sourced from PubChem (CID 71868107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).