C16H24F3N3O2 — CID 71868457
1-N-(cyclohex-3-en-1-ylmethyl)-3-N-(2,2,2-trifluoroethyl)piperidine-1,3-dicarboxamide (PubChem CID 71868457) has the molecular formula C16H24F3N3O2 and a molecular weight of 347.38 g/mol. Its IUPAC name is 1-N-(cyclohex-3-en-1-ylmethyl)-3-N-(2,2,2-trifluoroethyl)piperidine-1,3-dicarboxamide.
| Compound Name | 1-N-(cyclohex-3-en-1-ylmethyl)-3-N-(2,2,2-trifluoroethyl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 71868457 |
| Molecular Formula | C16H24F3N3O2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 1-N-(cyclohex-3-en-1-ylmethyl)-3-N-(2,2,2-trifluoroethyl)piperidine-1,3-dicarboxamide |
| SMILES | O=C(NCC(F)(F)F)C1CCCN(C(=O)NCC2CC=CCC2)C1 |
| InChI | InChI=1S/C16H24F3N3O2/c17-16(18,19)11-21-14(23)13-7-4-8-22(10-13)15(24)20-9-12-5-2-1-3-6-12/h1-2,12-13H,3-11H2,(H,20,24)(H,21,23) |
| InChIKey | HNGCPDQFCLAJEU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|