About N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-4-propan-2-ylpiperidine-1-carboxamide
N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-4-propan-2-ylpiperidine-1-carboxamide (PubChem CID 71868463) has the molecular formula C18H32N4O2
and a molecular weight of 336.48 g/mol. Its IUPAC name is N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-4-propan-2-ylpiperidine-1-carboxamide.
Molecular Properties
| Compound Name | N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-4-propan-2-ylpiperidine-1-carboxamide |
| PubChem CID | 71868463 |
| Molecular Formula | C18H32N4O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-4-propan-2-ylpiperidine-1-carboxamide |
| SMILES | COCCn1nc(C)c(CNC(=O)N2CCC(C(C)C)CC2)c1C |
| InChI | InChI=1S/C18H32N4O2/c1-13(2)16-6-8-21(9-7-16)18(23)19-12-17-14(3)20-22(15(17)4)10-11-24-5/h13,16H,6-12H2,1-5H3,(H,19,23) |
| InChIKey | BBWXTGSGNXQHGM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-4-propan-2-ylpiperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-4-propan-2-ylpiperidine-1-carboxamide?
The IUPAC name of N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-4-propan-2-ylpiperidine-1-carboxamide (CID 71868463) is N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-4-propan-2-ylpiperidine-1-carboxamide.
What is the SMILES notation for N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-4-propan-2-ylpiperidine-1-carboxamide?
The canonical SMILES for N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-4-propan-2-ylpiperidine-1-carboxamide is COCCn1nc(C)c(CNC(=O)N2CCC(C(C)C)CC2)c1C.
What is the InChIKey of N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-4-propan-2-ylpiperidine-1-carboxamide?
The InChIKey is BBWXTGSGNXQHGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32N4O2/c1-13(2)16-6-8-21(9-7-16)18(23)19-12-17-14(3)20-22(15(17)4)10-11-24-5/h13,16H,6-12H2,1-5H3,(H,19,23).
What are the key properties of N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-4-propan-2-ylpiperidine-1-carboxamide?
N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-4-propan-2-ylpiperidine-1-carboxamide has a molecular weight of 336.48 g/mol, XLogP of 2.72, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-4-propan-2-ylpiperidine-1-carboxamide is sourced from PubChem (CID 71868463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).