About 2-(4-fluorophenoxy)ethyl 3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)propanoate
2-(4-fluorophenoxy)ethyl 3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)propanoate (PubChem CID 71868554) has the molecular formula C16H17FN2O4
and a molecular weight of 320.32 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)ethyl 3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)propanoate.
Molecular Properties
| Compound Name | 2-(4-fluorophenoxy)ethyl 3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)propanoate |
| PubChem CID | 71868554 |
| Molecular Formula | C16H17FN2O4 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-(4-fluorophenoxy)ethyl 3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)propanoate |
| SMILES | O=C(CCc1nc(C2CC2)no1)OCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C16H17FN2O4/c17-12-3-5-13(6-4-12)21-9-10-22-15(20)8-7-14-18-16(19-23-14)11-1-2-11/h3-6,11H,1-2,7-10H2 |
| InChIKey | FBQAWIPWNGWYGF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-fluorophenoxy)ethyl 3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenoxy)ethyl 3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)propanoate?
The IUPAC name of 2-(4-fluorophenoxy)ethyl 3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)propanoate (CID 71868554) is 2-(4-fluorophenoxy)ethyl 3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)propanoate.
What is the SMILES notation for 2-(4-fluorophenoxy)ethyl 3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)propanoate?
The canonical SMILES for 2-(4-fluorophenoxy)ethyl 3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)propanoate is O=C(CCc1nc(C2CC2)no1)OCCOc1ccc(F)cc1.
What is the InChIKey of 2-(4-fluorophenoxy)ethyl 3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)propanoate?
The InChIKey is FBQAWIPWNGWYGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17FN2O4/c17-12-3-5-13(6-4-12)21-9-10-22-15(20)8-7-14-18-16(19-23-14)11-1-2-11/h3-6,11H,1-2,7-10H2.
What are the key properties of 2-(4-fluorophenoxy)ethyl 3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)propanoate?
2-(4-fluorophenoxy)ethyl 3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)propanoate has a molecular weight of 320.32 g/mol, XLogP of 2.64, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenoxy)ethyl 3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)propanoate is sourced from PubChem (CID 71868554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).