C12H19F3N2O3 — CID 71868565
1-(1,4-dioxaspiro[4.5]decan-8-yl)-3-(3,3,3-trifluoropropyl)urea (PubChem CID 71868565) has the molecular formula C12H19F3N2O3 and a molecular weight of 296.29 g/mol. Its IUPAC name is 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3-(3,3,3-trifluoropropyl)urea.
| Compound Name | 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3-(3,3,3-trifluoropropyl)urea |
|---|---|
| PubChem CID | 71868565 |
| Molecular Formula | C12H19F3N2O3 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3-(3,3,3-trifluoropropyl)urea |
| SMILES | O=C(NCCC(F)(F)F)NC1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C12H19F3N2O3/c13-12(14,15)5-6-16-10(18)17-9-1-3-11(4-2-9)19-7-8-20-11/h9H,1-8H2,(H2,16,17,18) |
| InChIKey | GPIVLOMOPOBPIG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |