About 1-[2-[2-(4-methyl-1,3-thiazol-2-yl)propan-2-ylamino]acetyl]piperidine-3-carboxamide
1-[2-[2-(4-methyl-1,3-thiazol-2-yl)propan-2-ylamino]acetyl]piperidine-3-carboxamide (PubChem CID 71868987) has the molecular formula C15H24N4O2S
and a molecular weight of 324.45 g/mol. Its IUPAC name is 1-[2-[2-(4-methyl-1,3-thiazol-2-yl)propan-2-ylamino]acetyl]piperidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-[2-[2-(4-methyl-1,3-thiazol-2-yl)propan-2-ylamino]acetyl]piperidine-3-carboxamide |
| PubChem CID | 71868987 |
| Molecular Formula | C15H24N4O2S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 1-[2-[2-(4-methyl-1,3-thiazol-2-yl)propan-2-ylamino]acetyl]piperidine-3-carboxamide |
| SMILES | Cc1csc(C(C)(C)NCC(=O)N2CCCC(C(N)=O)C2)n1 |
| InChI | InChI=1S/C15H24N4O2S/c1-10-9-22-14(18-10)15(2,3)17-7-12(20)19-6-4-5-11(8-19)13(16)21/h9,11,17H,4-8H2,1-3H3,(H2,16,21) |
| InChIKey | DNIZRBLCEVCWAF-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-[2-(4-methyl-1,3-thiazol-2-yl)propan-2-ylamino]acetyl]piperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[2-(4-methyl-1,3-thiazol-2-yl)propan-2-ylamino]acetyl]piperidine-3-carboxamide?
The IUPAC name of 1-[2-[2-(4-methyl-1,3-thiazol-2-yl)propan-2-ylamino]acetyl]piperidine-3-carboxamide (CID 71868987) is 1-[2-[2-(4-methyl-1,3-thiazol-2-yl)propan-2-ylamino]acetyl]piperidine-3-carboxamide.
What is the SMILES notation for 1-[2-[2-(4-methyl-1,3-thiazol-2-yl)propan-2-ylamino]acetyl]piperidine-3-carboxamide?
The canonical SMILES for 1-[2-[2-(4-methyl-1,3-thiazol-2-yl)propan-2-ylamino]acetyl]piperidine-3-carboxamide is Cc1csc(C(C)(C)NCC(=O)N2CCCC(C(N)=O)C2)n1.
What is the InChIKey of 1-[2-[2-(4-methyl-1,3-thiazol-2-yl)propan-2-ylamino]acetyl]piperidine-3-carboxamide?
The InChIKey is DNIZRBLCEVCWAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N4O2S/c1-10-9-22-14(18-10)15(2,3)17-7-12(20)19-6-4-5-11(8-19)13(16)21/h9,11,17H,4-8H2,1-3H3,(H2,16,21).
What are the key properties of 1-[2-[2-(4-methyl-1,3-thiazol-2-yl)propan-2-ylamino]acetyl]piperidine-3-carboxamide?
1-[2-[2-(4-methyl-1,3-thiazol-2-yl)propan-2-ylamino]acetyl]piperidine-3-carboxamide has a molecular weight of 324.45 g/mol, XLogP of 1.00, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[2-(4-methyl-1,3-thiazol-2-yl)propan-2-ylamino]acetyl]piperidine-3-carboxamide is sourced from PubChem (CID 71868987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).