About N-[2-methyl-5-(2-oxo-1,3-oxazolidin-3-yl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide
N-[2-methyl-5-(2-oxo-1,3-oxazolidin-3-yl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 71869091) has the molecular formula C18H20N2O3
and a molecular weight of 312.37 g/mol. Its IUPAC name is N-[2-methyl-5-(2-oxo-1,3-oxazolidin-3-yl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
Molecular Properties
| Compound Name | N-[2-methyl-5-(2-oxo-1,3-oxazolidin-3-yl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| PubChem CID | 71869091 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | N-[2-methyl-5-(2-oxo-1,3-oxazolidin-3-yl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | Cc1ccc(N2CCOC2=O)cc1NC(=O)C1CC2C=CC1C2 |
| InChI | InChI=1S/C18H20N2O3/c1-11-2-5-14(20-6-7-23-18(20)22)10-16(11)19-17(21)15-9-12-3-4-13(15)8-12/h2-5,10,12-13,15H,6-9H2,1H3,(H,19,21) |
| InChIKey | WIXAYLYONJFMAP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[2-methyl-5-(2-oxo-1,3-oxazolidin-3-yl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-methyl-5-(2-oxo-1,3-oxazolidin-3-yl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide?
The IUPAC name of N-[2-methyl-5-(2-oxo-1,3-oxazolidin-3-yl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (CID 71869091) is N-[2-methyl-5-(2-oxo-1,3-oxazolidin-3-yl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
What is the SMILES notation for N-[2-methyl-5-(2-oxo-1,3-oxazolidin-3-yl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide?
The canonical SMILES for N-[2-methyl-5-(2-oxo-1,3-oxazolidin-3-yl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide is Cc1ccc(N2CCOC2=O)cc1NC(=O)C1CC2C=CC1C2.
What is the InChIKey of N-[2-methyl-5-(2-oxo-1,3-oxazolidin-3-yl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide?
The InChIKey is WIXAYLYONJFMAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O3/c1-11-2-5-14(20-6-7-23-18(20)22)10-16(11)19-17(21)15-9-12-3-4-13(15)8-12/h2-5,10,12-13,15H,6-9H2,1H3,(H,19,21).
What are the key properties of N-[2-methyl-5-(2-oxo-1,3-oxazolidin-3-yl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide?
N-[2-methyl-5-(2-oxo-1,3-oxazolidin-3-yl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide has a molecular weight of 312.37 g/mol, XLogP of 3.10, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-methyl-5-(2-oxo-1,3-oxazolidin-3-yl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide is sourced from PubChem (CID 71869091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).