C11H10N2O4 — CID 71869279
(6-methoxy-3-pyridinyl)methyl 1,2-oxazole-3-carboxylate (PubChem CID 71869279) has the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. Its IUPAC name is (6-methoxy-3-pyridinyl)methyl 1,2-oxazole-3-carboxylate.
| Compound Name | (6-methoxy-3-pyridinyl)methyl 1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 71869279 |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | (6-methoxy-3-pyridinyl)methyl 1,2-oxazole-3-carboxylate |
| SMILES | COc1ccc(COC(=O)c2ccon2)cn1 |
| InChI | InChI=1S/C11H10N2O4/c1-15-10-3-2-8(6-12-10)7-16-11(14)9-4-5-17-13-9/h2-6H,7H2,1H3 |
| InChIKey | FVMDOAVZOGHZDS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |