About 2-(3,4-dihydro-2H-quinolin-1-yl)ethyl 4-methyl-1,3-thiazole-5-carboxylate
2-(3,4-dihydro-2H-quinolin-1-yl)ethyl 4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 71869335) has the molecular formula C16H18N2O2S
and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-quinolin-1-yl)ethyl 4-methyl-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | 2-(3,4-dihydro-2H-quinolin-1-yl)ethyl 4-methyl-1,3-thiazole-5-carboxylate |
| PubChem CID | 71869335 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-(3,4-dihydro-2H-quinolin-1-yl)ethyl 4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1ncsc1C(=O)OCCN1CCCc2ccccc21 |
| InChI | InChI=1S/C16H18N2O2S/c1-12-15(21-11-17-12)16(19)20-10-9-18-8-4-6-13-5-2-3-7-14(13)18/h2-3,5,7,11H,4,6,8-10H2,1H3 |
| InChIKey | OXUCLYTZIMAXHG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3,4-dihydro-2H-quinolin-1-yl)ethyl 4-methyl-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dihydro-2H-quinolin-1-yl)ethyl 4-methyl-1,3-thiazole-5-carboxylate?
The IUPAC name of 2-(3,4-dihydro-2H-quinolin-1-yl)ethyl 4-methyl-1,3-thiazole-5-carboxylate (CID 71869335) is 2-(3,4-dihydro-2H-quinolin-1-yl)ethyl 4-methyl-1,3-thiazole-5-carboxylate.
What is the SMILES notation for 2-(3,4-dihydro-2H-quinolin-1-yl)ethyl 4-methyl-1,3-thiazole-5-carboxylate?
The canonical SMILES for 2-(3,4-dihydro-2H-quinolin-1-yl)ethyl 4-methyl-1,3-thiazole-5-carboxylate is Cc1ncsc1C(=O)OCCN1CCCc2ccccc21.
What is the InChIKey of 2-(3,4-dihydro-2H-quinolin-1-yl)ethyl 4-methyl-1,3-thiazole-5-carboxylate?
The InChIKey is OXUCLYTZIMAXHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O2S/c1-12-15(21-11-17-12)16(19)20-10-9-18-8-4-6-13-5-2-3-7-14(13)18/h2-3,5,7,11H,4,6,8-10H2,1H3.
What are the key properties of 2-(3,4-dihydro-2H-quinolin-1-yl)ethyl 4-methyl-1,3-thiazole-5-carboxylate?
2-(3,4-dihydro-2H-quinolin-1-yl)ethyl 4-methyl-1,3-thiazole-5-carboxylate has a molecular weight of 302.40 g/mol, XLogP of 3.06, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dihydro-2H-quinolin-1-yl)ethyl 4-methyl-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 71869335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).