About N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboxamide
N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboxamide (PubChem CID 71869653) has the molecular formula C14H24N2O3
and a molecular weight of 268.36 g/mol. Its IUPAC name is N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboxamide.
Molecular Properties
| Compound Name | N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboxamide |
| PubChem CID | 71869653 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboxamide |
| SMILES | CC1(C)C(NC(=O)N2CCOCC2)C2CCCOC21 |
| InChI | InChI=1S/C14H24N2O3/c1-14(2)11(10-4-3-7-19-12(10)14)15-13(17)16-5-8-18-9-6-16/h10-12H,3-9H2,1-2H3,(H,15,17) |
| InChIKey | SHAQUKQMPYFEPJ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboxamide?
The IUPAC name of N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboxamide (CID 71869653) is N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboxamide.
What is the SMILES notation for N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboxamide?
The canonical SMILES for N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboxamide is CC1(C)C(NC(=O)N2CCOCC2)C2CCCOC21.
What is the InChIKey of N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboxamide?
The InChIKey is SHAQUKQMPYFEPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O3/c1-14(2)11(10-4-3-7-19-12(10)14)15-13(17)16-5-8-18-9-6-16/h10-12H,3-9H2,1-2H3,(H,15,17).
What are the key properties of N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboxamide?
N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboxamide has a molecular weight of 268.36 g/mol, XLogP of 1.23, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboxamide is sourced from PubChem (CID 71869653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).