C20H22BrN3O3 — CID 71869661
N-[(5-bromo-2-hydroxyphenyl)methyl]-3-(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)-N-ethylpropanamide (PubChem CID 71869661) has the molecular formula C20H22BrN3O3 and a molecular weight of 432.32 g/mol. Its IUPAC name is N-[(5-bromo-2-hydroxyphenyl)methyl]-3-(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)-N-ethylpropanamide.
| Compound Name | N-[(5-bromo-2-hydroxyphenyl)methyl]-3-(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)-N-ethylpropanamide |
|---|---|
| PubChem CID | 71869661 |
| Molecular Formula | C20H22BrN3O3 |
| Molecular Weight | 432.32 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | N-[(5-bromo-2-hydroxyphenyl)methyl]-3-(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)-N-ethylpropanamide |
| SMILES | CCN(Cc1cc(Br)ccc1O)C(=O)CCc1c(C)[nH]c(=O)c(C#N)c1C |
| InChI | InChI=1S/C20H22BrN3O3/c1-4-24(11-14-9-15(21)5-7-18(14)25)19(26)8-6-16-12(2)17(10-22)20(27)23-13(16)3/h5,7,9,25H,4,6,8,11H2,1-3H3,(H,23,27) |
| InChIKey | AWURAQOVQLIBSI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|