C20H26N4O — CID 71869708
(3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-[4-(4-methylpyrazol-1-yl)phenyl]methanone (PubChem CID 71869708) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is (3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-[4-(4-methylpyrazol-1-yl)phenyl]methanone.
| Compound Name | (3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-[4-(4-methylpyrazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 71869708 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | (3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-[4-(4-methylpyrazol-1-yl)phenyl]methanone |
| SMILES | CCC1CN2CCCC2CN1C(=O)c1ccc(-n2cc(C)cn2)cc1 |
| InChI | InChI=1S/C20H26N4O/c1-3-17-13-22-10-4-5-19(22)14-23(17)20(25)16-6-8-18(9-7-16)24-12-15(2)11-21-24/h6-9,11-12,17,19H,3-5,10,13-14H2,1-2H3 |
| InChIKey | ZXGRHBZEDXPSIB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |