About 1-(4-hydroxy-2,2-dimethylpentyl)-3-[(2-phenyloxolan-3-yl)methyl]urea
1-(4-hydroxy-2,2-dimethylpentyl)-3-[(2-phenyloxolan-3-yl)methyl]urea (PubChem CID 71869795) has the molecular formula C19H30N2O3
and a molecular weight of 334.46 g/mol. Its IUPAC name is 1-(4-hydroxy-2,2-dimethylpentyl)-3-[(2-phenyloxolan-3-yl)methyl]urea.
Molecular Properties
| Compound Name | 1-(4-hydroxy-2,2-dimethylpentyl)-3-[(2-phenyloxolan-3-yl)methyl]urea |
| PubChem CID | 71869795 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 1-(4-hydroxy-2,2-dimethylpentyl)-3-[(2-phenyloxolan-3-yl)methyl]urea |
| SMILES | CC(O)CC(C)(C)CNC(=O)NCC1CCOC1c1ccccc1 |
| InChI | InChI=1S/C19H30N2O3/c1-14(22)11-19(2,3)13-21-18(23)20-12-16-9-10-24-17(16)15-7-5-4-6-8-15/h4-8,14,16-17,22H,9-13H2,1-3H3,(H2,20,21,23) |
| InChIKey | YGFROOGMGKGCSD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-hydroxy-2,2-dimethylpentyl)-3-[(2-phenyloxolan-3-yl)methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-hydroxy-2,2-dimethylpentyl)-3-[(2-phenyloxolan-3-yl)methyl]urea?
The IUPAC name of 1-(4-hydroxy-2,2-dimethylpentyl)-3-[(2-phenyloxolan-3-yl)methyl]urea (CID 71869795) is 1-(4-hydroxy-2,2-dimethylpentyl)-3-[(2-phenyloxolan-3-yl)methyl]urea.
What is the SMILES notation for 1-(4-hydroxy-2,2-dimethylpentyl)-3-[(2-phenyloxolan-3-yl)methyl]urea?
The canonical SMILES for 1-(4-hydroxy-2,2-dimethylpentyl)-3-[(2-phenyloxolan-3-yl)methyl]urea is CC(O)CC(C)(C)CNC(=O)NCC1CCOC1c1ccccc1.
What is the InChIKey of 1-(4-hydroxy-2,2-dimethylpentyl)-3-[(2-phenyloxolan-3-yl)methyl]urea?
The InChIKey is YGFROOGMGKGCSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30N2O3/c1-14(22)11-19(2,3)13-21-18(23)20-12-16-9-10-24-17(16)15-7-5-4-6-8-15/h4-8,14,16-17,22H,9-13H2,1-3H3,(H2,20,21,23).
What are the key properties of 1-(4-hydroxy-2,2-dimethylpentyl)-3-[(2-phenyloxolan-3-yl)methyl]urea?
1-(4-hydroxy-2,2-dimethylpentyl)-3-[(2-phenyloxolan-3-yl)methyl]urea has a molecular weight of 334.46 g/mol, XLogP of 2.86, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-hydroxy-2,2-dimethylpentyl)-3-[(2-phenyloxolan-3-yl)methyl]urea is sourced from PubChem (CID 71869795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).