C22H21N5O2S — CID 71870068
N-[3-[5-[1-(6-methoxynaphthalen-2-yl)ethylsulfanyl]tetrazol-1-yl]phenyl]acetamide (PubChem CID 71870068) has the molecular formula C22H21N5O2S and a molecular weight of 419.51 g/mol. Its IUPAC name is N-[3-[5-[1-(6-methoxynaphthalen-2-yl)ethylsulfanyl]tetrazol-1-yl]phenyl]acetamide.
| Compound Name | N-[3-[5-[1-(6-methoxynaphthalen-2-yl)ethylsulfanyl]tetrazol-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 71870068 |
| Molecular Formula | C22H21N5O2S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | N-[3-[5-[1-(6-methoxynaphthalen-2-yl)ethylsulfanyl]tetrazol-1-yl]phenyl]acetamide |
| SMILES | COc1ccc2cc(C(C)Sc3nnnn3-c3cccc(NC(C)=O)c3)ccc2c1 |
| InChI | InChI=1S/C22H21N5O2S/c1-14(16-7-8-18-12-21(29-3)10-9-17(18)11-16)30-22-24-25-26-27(22)20-6-4-5-19(13-20)23-15(2)28/h4-14H,1-3H3,(H,23,28) |
| InChIKey | DLWDONFKCHJYMR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |